C13H17F2N — CID 156647917
2,3-difluoro-4-propan-2-ylbenzonitrile;propane (PubChem CID 156647917) has the molecular formula C13H17F2N and a molecular weight of 225.28 g/mol. Its IUPAC name is 2,3-difluoro-4-propan-2-ylbenzonitrile;propane.
| Compound Name | 2,3-difluoro-4-propan-2-ylbenzonitrile;propane |
|---|---|
| PubChem CID | 156647917 |
| Molecular Formula | C13H17F2N |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2,3-difluoro-4-propan-2-ylbenzonitrile;propane |
| SMILES | CC(C)c1ccc(C#N)c(F)c1F.CCC |
| InChI | InChI=1S/C10H9F2N.C3H8/c1-6(2)8-4-3-7(5-13)9(11)10(8)12;1-3-2/h3-4,6H,1-2H3;3H2,1-2H3 |
| InChIKey | IIUGWWUBEYPDFT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |