C14H18F2N2 — CID 107933841
4-(3-ethylpentan-2-ylamino)-2,3-difluorobenzonitrile (PubChem CID 107933841) has the molecular formula C14H18F2N2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 4-(3-ethylpentan-2-ylamino)-2,3-difluorobenzonitrile.
| Compound Name | 4-(3-ethylpentan-2-ylamino)-2,3-difluorobenzonitrile |
|---|---|
| PubChem CID | 107933841 |
| Molecular Formula | C14H18F2N2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 4-(3-ethylpentan-2-ylamino)-2,3-difluorobenzonitrile |
| SMILES | CCC(CC)C(C)Nc1ccc(C#N)c(F)c1F |
| InChI | InChI=1S/C14H18F2N2/c1-4-10(5-2)9(3)18-12-7-6-11(8-17)13(15)14(12)16/h6-7,9-10,18H,4-5H2,1-3H3 |
| InChIKey | ZOUZOZJQQJSCKW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |