C12H14F2N2O — CID 107934163
4-(2-ethoxypropylamino)-2,3-difluorobenzonitrile (PubChem CID 107934163) has the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. Its IUPAC name is 4-(2-ethoxypropylamino)-2,3-difluorobenzonitrile.
| Compound Name | 4-(2-ethoxypropylamino)-2,3-difluorobenzonitrile |
|---|---|
| PubChem CID | 107934163 |
| Molecular Formula | C12H14F2N2O |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 4-(2-ethoxypropylamino)-2,3-difluorobenzonitrile |
| SMILES | CCOC(C)CNc1ccc(C#N)c(F)c1F |
| InChI | InChI=1S/C12H14F2N2O/c1-3-17-8(2)7-16-10-5-4-9(6-15)11(13)12(10)14/h4-5,8,16H,3,7H2,1-2H3 |
| InChIKey | SMAPRAMEYAIXEC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |