C11H10F2N2O2 — CID 107933408
ethyl 2-(4-cyano-2,3-difluoroanilino)acetate (PubChem CID 107933408) has the molecular formula C11H10F2N2O2 and a molecular weight of 240.21 g/mol. Its IUPAC name is ethyl 2-(4-cyano-2,3-difluoroanilino)acetate.
| Compound Name | ethyl 2-(4-cyano-2,3-difluoroanilino)acetate |
|---|---|
| PubChem CID | 107933408 |
| Molecular Formula | C11H10F2N2O2 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | ethyl 2-(4-cyano-2,3-difluoroanilino)acetate |
| SMILES | CCOC(=O)CNc1ccc(C#N)c(F)c1F |
| InChI | InChI=1S/C11H10F2N2O2/c1-2-17-9(16)6-15-8-4-3-7(5-14)10(12)11(8)13/h3-4,15H,2,6H2,1H3 |
| InChIKey | PMTOFWIYRINVPL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |