C10H6F2N2 — CID 107933287
2,3-difluoro-4-(prop-2-ynylamino)benzonitrile (PubChem CID 107933287) has the molecular formula C10H6F2N2 and a molecular weight of 192.17 g/mol. Its IUPAC name is 2,3-difluoro-4-(prop-2-ynylamino)benzonitrile.
| Compound Name | 2,3-difluoro-4-(prop-2-ynylamino)benzonitrile |
|---|---|
| PubChem CID | 107933287 |
| Molecular Formula | C10H6F2N2 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2,3-difluoro-4-(prop-2-ynylamino)benzonitrile |
| SMILES | C#CCNc1ccc(C#N)c(F)c1F |
| InChI | InChI=1S/C10H6F2N2/c1-2-5-14-8-4-3-7(6-13)9(11)10(8)12/h1,3-4,14H,5H2 |
| InChIKey | CHWLNJRBXIXFQE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|