C11H12F2N2OS — CID 114017763
2,3-difluoro-4-(1-methylsulfinylpropan-2-ylamino)benzonitrile (PubChem CID 114017763) has the molecular formula C11H12F2N2OS and a molecular weight of 258.29 g/mol. Its IUPAC name is 2,3-difluoro-4-(1-methylsulfinylpropan-2-ylamino)benzonitrile.
| Compound Name | 2,3-difluoro-4-(1-methylsulfinylpropan-2-ylamino)benzonitrile |
|---|---|
| PubChem CID | 114017763 |
| Molecular Formula | C11H12F2N2OS |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2,3-difluoro-4-(1-methylsulfinylpropan-2-ylamino)benzonitrile |
| SMILES | CC(CS(C)=O)Nc1ccc(C#N)c(F)c1F |
| InChI | InChI=1S/C11H12F2N2OS/c1-7(6-17(2)16)15-9-4-3-8(5-14)10(12)11(9)13/h3-4,7,15H,6H2,1-2H3 |
| InChIKey | FEIMBDXXKVDIDQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |