C12H13F3N2OS — CID 99626307
3-[[(2S)-1-[(S)-methylsulfinyl]propan-2-yl]amino]-4-(trifluoromethyl)benzonitrile (PubChem CID 99626307) has the molecular formula C12H13F3N2OS and a molecular weight of 290.31 g/mol. Its IUPAC name is 3-[[(2S)-1-[(S)-methylsulfinyl]propan-2-yl]amino]-4-(trifluoromethyl)benzonitrile.
| Compound Name | 3-[[(2S)-1-[(S)-methylsulfinyl]propan-2-yl]amino]-4-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 99626307 |
| Molecular Formula | C12H13F3N2OS |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-[[(2S)-1-[(S)-methylsulfinyl]propan-2-yl]amino]-4-(trifluoromethyl)benzonitrile |
| SMILES | C[C@@H](C[S@](C)=O)Nc1cc(C#N)ccc1C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2OS/c1-8(7-19(2)18)17-11-5-9(6-16)3-4-10(11)12(13,14)15/h3-5,8,17H,7H2,1-2H3/t8-,19-/m0/s1 |
| InChIKey | HJOFLQMIVBKMMS-RLBGWGEZSA-N |
| XLogP | 2.76 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |