C16H21F3N4 — CID 86797700
3-[2-(4-methylpiperazin-1-yl)propylamino]-4-(trifluoromethyl)benzonitrile (PubChem CID 86797700) has the molecular formula C16H21F3N4 and a molecular weight of 326.37 g/mol. Its IUPAC name is 3-[2-(4-methylpiperazin-1-yl)propylamino]-4-(trifluoromethyl)benzonitrile.
| Compound Name | 3-[2-(4-methylpiperazin-1-yl)propylamino]-4-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 86797700 |
| Molecular Formula | C16H21F3N4 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3-[2-(4-methylpiperazin-1-yl)propylamino]-4-(trifluoromethyl)benzonitrile |
| SMILES | CC(CNc1cc(C#N)ccc1C(F)(F)F)N1CCN(C)CC1 |
| InChI | InChI=1S/C16H21F3N4/c1-12(23-7-5-22(2)6-8-23)11-21-15-9-13(10-20)3-4-14(15)16(17,18)19/h3-4,9,12,21H,5-8,11H2,1-2H3 |
| InChIKey | UCTCJOWQYSQREC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 42.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |