C12H14F3N3O2S — CID 86797695
N-[2-[5-cyano-2-(trifluoromethyl)anilino]ethyl]ethanesulfonamide (PubChem CID 86797695) has the molecular formula C12H14F3N3O2S and a molecular weight of 321.32 g/mol. Its IUPAC name is N-[2-[5-cyano-2-(trifluoromethyl)anilino]ethyl]ethanesulfonamide.
| Compound Name | N-[2-[5-cyano-2-(trifluoromethyl)anilino]ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 86797695 |
| Molecular Formula | C12H14F3N3O2S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-[2-[5-cyano-2-(trifluoromethyl)anilino]ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCNc1cc(C#N)ccc1C(F)(F)F |
| InChI | InChI=1S/C12H14F3N3O2S/c1-2-21(19,20)18-6-5-17-11-7-9(8-16)3-4-10(11)12(13,14)15/h3-4,7,17-18H,2,5-6H2,1H3 |
| InChIKey | KEFOXYCPFIHOLI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|