C14H18F3N3 — CID 107444968
4-[2-(tert-butylamino)ethylamino]-3-(trifluoromethyl)benzonitrile (PubChem CID 107444968) has the molecular formula C14H18F3N3 and a molecular weight of 285.31 g/mol. Its IUPAC name is 4-[2-(tert-butylamino)ethylamino]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[2-(tert-butylamino)ethylamino]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 107444968 |
| Molecular Formula | C14H18F3N3 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 4-[2-(tert-butylamino)ethylamino]-3-(trifluoromethyl)benzonitrile |
| SMILES | CC(C)(C)NCCNc1ccc(C#N)cc1C(F)(F)F |
| InChI | InChI=1S/C14H18F3N3/c1-13(2,3)20-7-6-19-12-5-4-10(9-18)8-11(12)14(15,16)17/h4-5,8,19-20H,6-7H2,1-3H3 |
| InChIKey | HTVCWHXOUTVBQX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|