C17H21F3N2O — CID 133384916
4-[3-(2-hydroxycyclohexyl)propylamino]-3-(trifluoromethyl)benzonitrile (PubChem CID 133384916) has the molecular formula C17H21F3N2O and a molecular weight of 326.36 g/mol. Its IUPAC name is 4-[3-(2-hydroxycyclohexyl)propylamino]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-(2-hydroxycyclohexyl)propylamino]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 133384916 |
| Molecular Formula | C17H21F3N2O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 4-[3-(2-hydroxycyclohexyl)propylamino]-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(NCCCC2CCCCC2O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H21F3N2O/c18-17(19,20)14-10-12(11-21)7-8-15(14)22-9-3-5-13-4-1-2-6-16(13)23/h7-8,10,13,16,22-23H,1-6,9H2 |
| InChIKey | HOZDRDYSGGPMBP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|