C14H20F3N3O — CID 133421323
2-[3-[[6-(trifluoromethyl)pyridazin-3-yl]amino]propyl]cyclohexan-1-ol (PubChem CID 133421323) has the molecular formula C14H20F3N3O and a molecular weight of 303.33 g/mol. Its IUPAC name is 2-[3-[[6-(trifluoromethyl)pyridazin-3-yl]amino]propyl]cyclohexan-1-ol.
| Compound Name | 2-[3-[[6-(trifluoromethyl)pyridazin-3-yl]amino]propyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 133421323 |
| Molecular Formula | C14H20F3N3O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-[3-[[6-(trifluoromethyl)pyridazin-3-yl]amino]propyl]cyclohexan-1-ol |
| SMILES | OC1CCCCC1CCCNc1ccc(C(F)(F)F)nn1 |
| InChI | InChI=1S/C14H20F3N3O/c15-14(16,17)12-7-8-13(20-19-12)18-9-3-5-10-4-1-2-6-11(10)21/h7-8,10-11,21H,1-6,9H2,(H,18,20) |
| InChIKey | NSZOJZUCAQLICC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|