C10H14F3N3S — CID 113344350
N-(3-methylsulfanylbutyl)-6-(trifluoromethyl)pyridazin-3-amine (PubChem CID 113344350) has the molecular formula C10H14F3N3S and a molecular weight of 265.30 g/mol. Its IUPAC name is N-(3-methylsulfanylbutyl)-6-(trifluoromethyl)pyridazin-3-amine.
| Compound Name | N-(3-methylsulfanylbutyl)-6-(trifluoromethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 113344350 |
| Molecular Formula | C10H14F3N3S |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | N-(3-methylsulfanylbutyl)-6-(trifluoromethyl)pyridazin-3-amine |
| SMILES | CSC(C)CCNc1ccc(C(F)(F)F)nn1 |
| InChI | InChI=1S/C10H14F3N3S/c1-7(17-2)5-6-14-9-4-3-8(15-16-9)10(11,12)13/h3-4,7H,5-6H2,1-2H3,(H,14,16) |
| InChIKey | DKVCAQXGLJIVOM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |