C11H17F3N4O — CID 103952486
N-[2-[2-(dimethylamino)ethoxy]ethyl]-6-(trifluoromethyl)pyridazin-3-amine (PubChem CID 103952486) has the molecular formula C11H17F3N4O and a molecular weight of 278.28 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethoxy]ethyl]-6-(trifluoromethyl)pyridazin-3-amine.
| Compound Name | N-[2-[2-(dimethylamino)ethoxy]ethyl]-6-(trifluoromethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 103952486 |
| Molecular Formula | C11H17F3N4O |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethoxy]ethyl]-6-(trifluoromethyl)pyridazin-3-amine |
| SMILES | CN(C)CCOCCNc1ccc(C(F)(F)F)nn1 |
| InChI | InChI=1S/C11H17F3N4O/c1-18(2)6-8-19-7-5-15-10-4-3-9(16-17-10)11(12,13)14/h3-4H,5-8H2,1-2H3,(H,15,17) |
| InChIKey | FTXPPOYGFWINAV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|