C18H24F3NO2S — CID 54512075
3-decylsulfonyl-4-(trifluoromethyl)benzonitrile (PubChem CID 54512075) has the molecular formula C18H24F3NO2S and a molecular weight of 375.46 g/mol. Its IUPAC name is 3-decylsulfonyl-4-(trifluoromethyl)benzonitrile.
| Compound Name | 3-decylsulfonyl-4-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 54512075 |
| Molecular Formula | C18H24F3NO2S |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 3-decylsulfonyl-4-(trifluoromethyl)benzonitrile |
| SMILES | CCCCCCCCCCS(=O)(=O)c1cc(C#N)ccc1C(F)(F)F |
| InChI | InChI=1S/C18H24F3NO2S/c1-2-3-4-5-6-7-8-9-12-25(23,24)17-13-15(14-22)10-11-16(17)18(19,20)21/h10-11,13H,2-9,12H2,1H3 |
| InChIKey | LTZSVEGPDIZEFQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|