C25H37F3N2O4S — CID 71103508
(2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-11-pentylsulfonylundecanamide (PubChem CID 71103508) has the molecular formula C25H37F3N2O4S and a molecular weight of 518.64 g/mol. Its IUPAC name is (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-11-pentylsulfonylundecanamide.
| Compound Name | (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-11-pentylsulfonylundecanamide |
|---|---|
| PubChem CID | 71103508 |
| Molecular Formula | C25H37F3N2O4S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-11-pentylsulfonylundecanamide |
| SMILES | CCCCCS(=O)(=O)CCCCCCCCC[C@](C)(O)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H37F3N2O4S/c1-3-4-11-16-35(33,34)17-12-9-7-5-6-8-10-15-24(2,32)23(31)30-21-14-13-20(19-29)22(18-21)25(26,27)28/h13-14,18,32H,3-12,15-17H2,1-2H3,(H,30,31)/t24-/m0/s1 |
| InChIKey | YTGBGTFXVGWSGM-DEOSSOPVSA-N |
| XLogP | 5.99 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|