C21H24F8N2O4S — CID 87719130
N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-7-(4,4,5,5,5-pentafluoropentylsulfonyl)heptanamide (PubChem CID 87719130) has the molecular formula C21H24F8N2O4S and a molecular weight of 552.48 g/mol. Its IUPAC name is N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-7-(4,4,5,5,5-pentafluoropentylsulfonyl)heptanamide.
| Compound Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-7-(4,4,5,5,5-pentafluoropentylsulfonyl)heptanamide |
|---|---|
| PubChem CID | 87719130 |
| Molecular Formula | C21H24F8N2O4S |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-7-(4,4,5,5,5-pentafluoropentylsulfonyl)heptanamide |
| SMILES | CC(O)(CCCCCS(=O)(=O)CCCC(F)(F)C(F)(F)F)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H24F8N2O4S/c1-18(33,17(32)31-15-7-6-14(13-30)16(12-15)20(24,25)26)8-3-2-4-10-36(34,35)11-5-9-19(22,23)21(27,28)29/h6-7,12,33H,2-5,8-11H2,1H3,(H,31,32) |
| InChIKey | ZOENMUGWONQMML-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|