C27H37F8N3O2S — CID 87719190
(2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-3-[methyl-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]amino]propanamide (PubChem CID 87719190) has the molecular formula C27H37F8N3O2S and a molecular weight of 619.66 g/mol. Its IUPAC name is (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-3-[methyl-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]amino]propanamide.
| Compound Name | (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-3-[methyl-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]amino]propanamide |
|---|---|
| PubChem CID | 87719190 |
| Molecular Formula | C27H37F8N3O2S |
| Molecular Weight | 619.66 g/mol |
| Exact Mass | 619.25 |
| IUPAC Name | (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-3-[methyl-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]amino]propanamide |
| SMILES | CN(CCCCCCCCCSCCCC(F)(F)C(F)(F)F)C[C@](C)(O)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H37F8N3O2S/c1-24(40,23(39)37-21-12-11-20(18-36)22(17-21)26(30,31)32)19-38(2)14-8-6-4-3-5-7-9-15-41-16-10-13-25(28,29)27(33,34)35/h11-12,17,40H,3-10,13-16,19H2,1-2H3,(H,37,39)/t24-/m0/s1 |
| InChIKey | XMKGGLBVOIQSJN-DEOSSOPVSA-N |
| XLogP | 7.64 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.66 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|