C23H33F3N2O4S — CID 69163757
(2S)-10-butylsulfonyl-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyldecanamide (PubChem CID 69163757) has the molecular formula C23H33F3N2O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is (2S)-10-butylsulfonyl-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyldecanamide.
| Compound Name | (2S)-10-butylsulfonyl-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyldecanamide |
|---|---|
| PubChem CID | 69163757 |
| Molecular Formula | C23H33F3N2O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | (2S)-10-butylsulfonyl-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyldecanamide |
| SMILES | CCCCS(=O)(=O)CCCCCCCC[C@](C)(O)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H33F3N2O4S/c1-3-4-14-33(31,32)15-10-8-6-5-7-9-13-22(2,30)21(29)28-19-12-11-18(17-27)20(16-19)23(24,25)26/h11-12,16,30H,3-10,13-15H2,1-2H3,(H,28,29)/t22-/m0/s1 |
| InChIKey | GLDKAENAIOSMAA-QFIPXVFZSA-N |
| XLogP | 5.21 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|