C23H31F3N2O4 — CID 69164862
(2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-9-(oxan-2-yloxy)nonanamide (PubChem CID 69164862) has the molecular formula C23H31F3N2O4 and a molecular weight of 456.51 g/mol. Its IUPAC name is (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-9-(oxan-2-yloxy)nonanamide.
| Compound Name | (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-9-(oxan-2-yloxy)nonanamide |
|---|---|
| PubChem CID | 69164862 |
| Molecular Formula | C23H31F3N2O4 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | (2S)-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-9-(oxan-2-yloxy)nonanamide |
| SMILES | C[C@](O)(CCCCCCCOC1CCCCO1)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H31F3N2O4/c1-22(30,12-6-3-2-4-7-13-31-20-9-5-8-14-32-20)21(29)28-18-11-10-17(16-27)19(15-18)23(24,25)26/h10-11,15,20,30H,2-9,12-14H2,1H3,(H,28,29)/t20?,22-/m0/s1 |
| InChIKey | MJNUIHCRPNSMFL-IAXKEJLGSA-N |
| XLogP | 5.15 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|