C25H30F10N2O4S2 — CID 87729722
(2S)-N-[4-cyano-3-(trifluoromethylsulfonyl)phenyl]-11-(3,3,4,4,5,5,5-heptafluoropentylsulfanyl)-2-hydroxy-2-methylundecanamide (PubChem CID 87729722) has the molecular formula C25H30F10N2O4S2 and a molecular weight of 676.64 g/mol. Its IUPAC name is (2S)-N-[4-cyano-3-(trifluoromethylsulfonyl)phenyl]-11-(3,3,4,4,5,5,5-heptafluoropentylsulfanyl)-2-hydroxy-2-methylundecanamide.
| Compound Name | (2S)-N-[4-cyano-3-(trifluoromethylsulfonyl)phenyl]-11-(3,3,4,4,5,5,5-heptafluoropentylsulfanyl)-2-hydroxy-2-methylundecanamide |
|---|---|
| PubChem CID | 87729722 |
| Molecular Formula | C25H30F10N2O4S2 |
| Molecular Weight | 676.64 g/mol |
| Exact Mass | 676.15 |
| IUPAC Name | (2S)-N-[4-cyano-3-(trifluoromethylsulfonyl)phenyl]-11-(3,3,4,4,5,5,5-heptafluoropentylsulfanyl)-2-hydroxy-2-methylundecanamide |
| SMILES | C[C@](O)(CCCCCCCCCSCCC(F)(F)C(F)(F)C(F)(F)F)C(=O)Nc1ccc(C#N)c(S(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C25H30F10N2O4S2/c1-21(39,20(38)37-18-10-9-17(16-36)19(15-18)43(40,41)25(33,34)35)11-7-5-3-2-4-6-8-13-42-14-12-22(26,27)23(28,29)24(30,31)32/h9-10,15,39H,2-8,11-14H2,1H3,(H,37,38)/t21-/m0/s1 |
| InChIKey | NMXVNKAGEFUQBS-NRFANRHFSA-N |
| XLogP | 7.62 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.64 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|