C15H18ClF3O3S — CID 18927273
4-hexylsulfonyl-2-methyl-5-(trifluoromethyl)benzoyl chloride (PubChem CID 18927273) has the molecular formula C15H18ClF3O3S and a molecular weight of 370.82 g/mol. Its IUPAC name is 4-hexylsulfonyl-2-methyl-5-(trifluoromethyl)benzoyl chloride.
| Compound Name | 4-hexylsulfonyl-2-methyl-5-(trifluoromethyl)benzoyl chloride |
|---|---|
| PubChem CID | 18927273 |
| Molecular Formula | C15H18ClF3O3S |
| Molecular Weight | 370.82 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 4-hexylsulfonyl-2-methyl-5-(trifluoromethyl)benzoyl chloride |
| SMILES | CCCCCCS(=O)(=O)c1cc(C)c(C(=O)Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C15H18ClF3O3S/c1-3-4-5-6-7-23(21,22)13-8-10(2)11(14(16)20)9-12(13)15(17,18)19/h8-9H,3-7H2,1-2H3 |
| InChIKey | DABMIQVUARGNAT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.82 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|