C27H32ClF6N3O6S2 — CID 158201155
4-butylsulfonyl-N-(diaminomethylidene)-2-methyl-5-(trifluoromethyl)benzamide;4-butylsulfonyl-2-methyl-5-(trifluoromethyl)benzoyl chloride (PubChem CID 158201155) has the molecular formula C27H32ClF6N3O6S2 and a molecular weight of 708.14 g/mol. Its IUPAC name is 4-butylsulfonyl-N-(diaminomethylidene)-2-methyl-5-(trifluoromethyl)benzamide;4-butylsulfonyl-2-methyl-5-(trifluoromethyl)benzoyl chloride.
| Compound Name | 4-butylsulfonyl-N-(diaminomethylidene)-2-methyl-5-(trifluoromethyl)benzamide;4-butylsulfonyl-2-methyl-5-(trifluoromethyl)benzoyl chloride |
|---|---|
| PubChem CID | 158201155 |
| Molecular Formula | C27H32ClF6N3O6S2 |
| Molecular Weight | 708.14 g/mol |
| Exact Mass | 707.13 |
| IUPAC Name | 4-butylsulfonyl-N-(diaminomethylidene)-2-methyl-5-(trifluoromethyl)benzamide;4-butylsulfonyl-2-methyl-5-(trifluoromethyl)benzoyl chloride |
| SMILES | CCCCS(=O)(=O)c1cc(C)c(C(=O)Cl)cc1C(F)(F)F.CCCCS(=O)(=O)c1cc(C)c(C(=O)N=C(N)N)cc1C(F)(F)F |
| InChI | InChI=1S/C14H18F3N3O3S.C13H14ClF3O3S/c1-3-4-5-24(22,23)11-6-8(2)9(12(21)20-13(18)19)7-10(11)14(15,16)17;1-3-4-5-21(19,20)11-6-8(2)9(12(14)18)7-10(11)13(15,16)17/h6-7H,3-5H2,1-2H3,(H4,18,19,20,21);6-7H,3-5H2,1-2H3 |
| InChIKey | GAYIFUMWKOEMQL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 166.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.14 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|