C17H24F3N3O — CID 18925748
2-butyl-4-tert-butyl-N-(diaminomethylidene)-5-(trifluoromethyl)benzamide (PubChem CID 18925748) has the molecular formula C17H24F3N3O and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-butyl-4-tert-butyl-N-(diaminomethylidene)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-butyl-4-tert-butyl-N-(diaminomethylidene)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 18925748 |
| Molecular Formula | C17H24F3N3O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-butyl-4-tert-butyl-N-(diaminomethylidene)-5-(trifluoromethyl)benzamide |
| SMILES | CCCCc1cc(C(C)(C)C)c(C(F)(F)F)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C17H24F3N3O/c1-5-6-7-10-8-12(16(2,3)4)13(17(18,19)20)9-11(10)14(24)23-15(21)22/h8-9H,5-7H2,1-4H3,(H4,21,22,23,24) |
| InChIKey | GTRKXMHZAOAETM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|