C19H20F3N3OS — CID 18927162
N-(diaminomethylidene)-4-(2,4-dimethylphenyl)sulfanyl-2-ethyl-5-(trifluoromethyl)benzamide (PubChem CID 18927162) has the molecular formula C19H20F3N3OS and a molecular weight of 395.45 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-(2,4-dimethylphenyl)sulfanyl-2-ethyl-5-(trifluoromethyl)benzamide.
| Compound Name | N-(diaminomethylidene)-4-(2,4-dimethylphenyl)sulfanyl-2-ethyl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 18927162 |
| Molecular Formula | C19H20F3N3OS |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-(diaminomethylidene)-4-(2,4-dimethylphenyl)sulfanyl-2-ethyl-5-(trifluoromethyl)benzamide |
| SMILES | CCc1cc(Sc2ccc(C)cc2C)c(C(F)(F)F)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C19H20F3N3OS/c1-4-12-8-16(27-15-6-5-10(2)7-11(15)3)14(19(20,21)22)9-13(12)17(26)25-18(23)24/h5-9H,4H2,1-3H3,(H4,23,24,25,26) |
| InChIKey | CFLLWKVNYSULCQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|