C11H9F3N4O — CID 18925711
4-cyano-N-(diaminomethylidene)-2-methyl-5-(trifluoromethyl)benzamide (PubChem CID 18925711) has the molecular formula C11H9F3N4O and a molecular weight of 270.21 g/mol. Its IUPAC name is 4-cyano-N-(diaminomethylidene)-2-methyl-5-(trifluoromethyl)benzamide.
| Compound Name | 4-cyano-N-(diaminomethylidene)-2-methyl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 18925711 |
| Molecular Formula | C11H9F3N4O |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-cyano-N-(diaminomethylidene)-2-methyl-5-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(C#N)c(C(F)(F)F)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C11H9F3N4O/c1-5-2-6(4-15)8(11(12,13)14)3-7(5)9(19)18-10(16)17/h2-3H,1H3,(H4,16,17,18,19) |
| InChIKey | ISKVIPAOWMEZGY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|