About 4-cyano-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;hydrochloride
4-cyano-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;hydrochloride (PubChem CID 67741587) has the molecular formula C11H13ClN4O3S
and a molecular weight of 316.77 g/mol. Its IUPAC name is 4-cyano-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;hydrochloride.
Molecular Properties
| Compound Name | 4-cyano-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;hydrochloride |
| PubChem CID | 67741587 |
| Molecular Formula | C11H13ClN4O3S |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 4-cyano-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;hydrochloride |
| SMILES | Cc1cc(C#N)c(S(C)(=O)=O)cc1C(=O)N=C(N)N.Cl |
| InChI | InChI=1S/C11H12N4O3S.ClH/c1-6-3-7(5-12)9(19(2,17)18)4-8(6)10(16)15-11(13)14;/h3-4H,1-2H3,(H4,13,14,15,16);1H |
| InChIKey | SLKOWOQWGVAQIE-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 139.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-cyano-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;hydrochloride?
The IUPAC name of 4-cyano-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;hydrochloride (CID 67741587) is 4-cyano-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;hydrochloride.
What is the SMILES notation for 4-cyano-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;hydrochloride?
The canonical SMILES for 4-cyano-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;hydrochloride is Cc1cc(C#N)c(S(C)(=O)=O)cc1C(=O)N=C(N)N.Cl.
What is the InChIKey of 4-cyano-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;hydrochloride?
The InChIKey is SLKOWOQWGVAQIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O3S.ClH/c1-6-3-7(5-12)9(19(2,17)18)4-8(6)10(16)15-11(13)14;/h3-4H,1-2H3,(H4,13,14,15,16);1H.
What are the key properties of 4-cyano-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;hydrochloride?
4-cyano-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;hydrochloride has a molecular weight of 316.77 g/mol, XLogP of 0.11, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;hydrochloride is sourced from PubChem (CID 67741587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).