C12H14N4O3S — CID 22101399
4-cyano-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide (PubChem CID 22101399) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is 4-cyano-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide.
| Compound Name | 4-cyano-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 22101399 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 4-cyano-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide |
| SMILES | CCc1cc(C#N)c(S(C)(=O)=O)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C12H14N4O3S/c1-3-7-4-8(6-13)10(20(2,18)19)5-9(7)11(17)16-12(14)15/h4-5H,3H2,1-2H3,(H4,14,15,16,17) |
| InChIKey | DYVWRAKIDVAEBW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 139.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|