C11H14FN3O3S — CID 22101398
N-(diaminomethylidene)-2-ethyl-4-fluoro-5-methylsulfonylbenzamide (PubChem CID 22101398) has the molecular formula C11H14FN3O3S and a molecular weight of 287.32 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-ethyl-4-fluoro-5-methylsulfonylbenzamide.
| Compound Name | N-(diaminomethylidene)-2-ethyl-4-fluoro-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 22101398 |
| Molecular Formula | C11H14FN3O3S |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | N-(diaminomethylidene)-2-ethyl-4-fluoro-5-methylsulfonylbenzamide |
| SMILES | CCc1cc(F)c(S(C)(=O)=O)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C11H14FN3O3S/c1-3-6-4-8(12)9(19(2,17)18)5-7(6)10(16)15-11(13)14/h4-5H,3H2,1-2H3,(H4,13,14,15,16) |
| InChIKey | RZIVXSRWYPNDGP-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|