C31H46ClN3O10S4 — CID 162240036
N-(diaminomethylidene)-2-ethyl-5-methylsulfonyl-4-pentan-3-ylsulfonylbenzamide;2-ethyl-5-methylsulfonyl-4-pentan-3-ylsulfonylbenzoyl chloride (PubChem CID 162240036) has the molecular formula C31H46ClN3O10S4 and a molecular weight of 784.44 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-ethyl-5-methylsulfonyl-4-pentan-3-ylsulfonylbenzamide;2-ethyl-5-methylsulfonyl-4-pentan-3-ylsulfonylbenzoyl chloride.
| Compound Name | N-(diaminomethylidene)-2-ethyl-5-methylsulfonyl-4-pentan-3-ylsulfonylbenzamide;2-ethyl-5-methylsulfonyl-4-pentan-3-ylsulfonylbenzoyl chloride |
|---|---|
| PubChem CID | 162240036 |
| Molecular Formula | C31H46ClN3O10S4 |
| Molecular Weight | 784.44 g/mol |
| Exact Mass | 783.18 |
| IUPAC Name | N-(diaminomethylidene)-2-ethyl-5-methylsulfonyl-4-pentan-3-ylsulfonylbenzamide;2-ethyl-5-methylsulfonyl-4-pentan-3-ylsulfonylbenzoyl chloride |
| SMILES | CCc1cc(S(=O)(=O)C(CC)CC)c(S(C)(=O)=O)cc1C(=O)Cl.CCc1cc(S(=O)(=O)C(CC)CC)c(S(C)(=O)=O)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C16H25N3O5S2.C15H21ClO5S2/c1-5-10-8-14(26(23,24)11(6-2)7-3)13(25(4,21)22)9-12(10)15(20)19-16(17)18;1-5-10-8-14(23(20,21)11(6-2)7-3)13(22(4,18)19)9-12(10)15(16)17/h8-9,11H,5-7H2,1-4H3,(H4,17,18,19,20);8-9,11H,5-7H2,1-4H3 |
| InChIKey | ZWOPXTQLBROVSU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 235.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|