C13H19N3O3S2 — CID 21467692
N-(diaminomethylidene)-2-ethyl-4-ethylsulfanyl-5-methylsulfonylbenzamide (PubChem CID 21467692) has the molecular formula C13H19N3O3S2 and a molecular weight of 329.45 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-ethyl-4-ethylsulfanyl-5-methylsulfonylbenzamide.
| Compound Name | N-(diaminomethylidene)-2-ethyl-4-ethylsulfanyl-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 21467692 |
| Molecular Formula | C13H19N3O3S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-(diaminomethylidene)-2-ethyl-4-ethylsulfanyl-5-methylsulfonylbenzamide |
| SMILES | CCSc1cc(CC)c(C(=O)N=C(N)N)cc1S(C)(=O)=O |
| InChI | InChI=1S/C13H19N3O3S2/c1-4-8-6-10(20-5-2)11(21(3,18)19)7-9(8)12(17)16-13(14)15/h6-7H,4-5H2,1-3H3,(H4,14,15,16,17) |
| InChIKey | KPQBJMYNVWPJQR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|