C15H23N3O3S — CID 18937147
4-butyl-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide (PubChem CID 18937147) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is 4-butyl-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide.
| Compound Name | 4-butyl-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 18937147 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 4-butyl-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide |
| SMILES | CCCCc1cc(CC)c(C(=O)N=C(N)N)cc1S(C)(=O)=O |
| InChI | InChI=1S/C15H23N3O3S/c1-4-6-7-11-8-10(5-2)12(14(19)18-15(16)17)9-13(11)22(3,20)21/h8-9H,4-7H2,1-3H3,(H4,16,17,18,19) |
| InChIKey | XIAOJYDPBVQSCV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|