C16H22N4O3S — CID 18937049
2-cyano-N-(diaminomethylidene)-4-hexyl-5-methylsulfonylbenzamide (PubChem CID 18937049) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-cyano-N-(diaminomethylidene)-4-hexyl-5-methylsulfonylbenzamide.
| Compound Name | 2-cyano-N-(diaminomethylidene)-4-hexyl-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 18937049 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-cyano-N-(diaminomethylidene)-4-hexyl-5-methylsulfonylbenzamide |
| SMILES | CCCCCCc1cc(C#N)c(C(=O)N=C(N)N)cc1S(C)(=O)=O |
| InChI | InChI=1S/C16H22N4O3S/c1-3-4-5-6-7-11-8-12(10-17)13(15(21)20-16(18)19)9-14(11)24(2,22)23/h8-9H,3-7H2,1-2H3,(H4,18,19,20,21) |
| InChIKey | QOEOHZFKLSTHMS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 139.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|