C14H21N3O5S2 — CID 18927147
N-(diaminomethylidene)-2-ethyl-5-methylsulfonyl-4-propylsulfonylbenzamide (PubChem CID 18927147) has the molecular formula C14H21N3O5S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-ethyl-5-methylsulfonyl-4-propylsulfonylbenzamide.
| Compound Name | N-(diaminomethylidene)-2-ethyl-5-methylsulfonyl-4-propylsulfonylbenzamide |
|---|---|
| PubChem CID | 18927147 |
| Molecular Formula | C14H21N3O5S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-(diaminomethylidene)-2-ethyl-5-methylsulfonyl-4-propylsulfonylbenzamide |
| SMILES | CCCS(=O)(=O)c1cc(CC)c(C(=O)N=C(N)N)cc1S(C)(=O)=O |
| InChI | InChI=1S/C14H21N3O5S2/c1-4-6-24(21,22)12-7-9(5-2)10(13(18)17-14(15)16)8-11(12)23(3,19)20/h7-8H,4-6H2,1-3H3,(H4,15,16,17,18) |
| InChIKey | SLQUHRGHMVPDEH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 149.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|