C27H34ClN3O10S4 — CID 158197490
4-cyclopropylsulfonyl-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide;4-cyclopropylsulfonyl-2-ethyl-5-methylsulfonylbenzoyl chloride (PubChem CID 158197490) has the molecular formula C27H34ClN3O10S4 and a molecular weight of 724.30 g/mol. Its IUPAC name is 4-cyclopropylsulfonyl-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide;4-cyclopropylsulfonyl-2-ethyl-5-methylsulfonylbenzoyl chloride.
| Compound Name | 4-cyclopropylsulfonyl-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide;4-cyclopropylsulfonyl-2-ethyl-5-methylsulfonylbenzoyl chloride |
|---|---|
| PubChem CID | 158197490 |
| Molecular Formula | C27H34ClN3O10S4 |
| Molecular Weight | 724.30 g/mol |
| Exact Mass | 723.08 |
| IUPAC Name | 4-cyclopropylsulfonyl-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide;4-cyclopropylsulfonyl-2-ethyl-5-methylsulfonylbenzoyl chloride |
| SMILES | CCc1cc(S(=O)(=O)C2CC2)c(S(C)(=O)=O)cc1C(=O)Cl.CCc1cc(S(=O)(=O)C2CC2)c(S(C)(=O)=O)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C14H19N3O5S2.C13H15ClO5S2/c1-3-8-6-12(24(21,22)9-4-5-9)11(23(2,19)20)7-10(8)13(18)17-14(15)16;1-3-8-6-12(21(18,19)9-4-5-9)11(20(2,16)17)7-10(8)13(14)15/h6-7,9H,3-5H2,1-2H3,(H4,15,16,17,18);6-7,9H,3-5H2,1-2H3 |
| InChIKey | GANAIYDOGGZNBK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 235.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|