C29H38ClN3O8S4 — CID 158950768
4-cyclobutylsulfinyl-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide;4-cyclobutylsulfinyl-2-ethyl-5-methylsulfonylbenzoyl chloride (PubChem CID 158950768) has the molecular formula C29H38ClN3O8S4 and a molecular weight of 720.36 g/mol. Its IUPAC name is 4-cyclobutylsulfinyl-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide;4-cyclobutylsulfinyl-2-ethyl-5-methylsulfonylbenzoyl chloride.
| Compound Name | 4-cyclobutylsulfinyl-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide;4-cyclobutylsulfinyl-2-ethyl-5-methylsulfonylbenzoyl chloride |
|---|---|
| PubChem CID | 158950768 |
| Molecular Formula | C29H38ClN3O8S4 |
| Molecular Weight | 720.36 g/mol |
| Exact Mass | 719.12 |
| IUPAC Name | 4-cyclobutylsulfinyl-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide;4-cyclobutylsulfinyl-2-ethyl-5-methylsulfonylbenzoyl chloride |
| SMILES | CCc1cc(S(=O)C2CCC2)c(S(C)(=O)=O)cc1C(=O)Cl.CCc1cc(S(=O)C2CCC2)c(S(C)(=O)=O)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C15H21N3O4S2.C14H17ClO4S2/c1-3-9-7-12(23(20)10-5-4-6-10)13(24(2,21)22)8-11(9)14(19)18-15(16)17;1-3-9-7-12(20(17)10-5-4-6-10)13(21(2,18)19)8-11(9)14(15)16/h7-8,10H,3-6H2,1-2H3,(H4,16,17,18,19);7-8,10H,3-6H2,1-2H3 |
| InChIKey | JLJYEDLJBSZWDZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 200.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|