C31H40ClN5O10S2 — CID 157077664
N-(diaminomethylidene)-2-ethyl-4-(2-methylcyclopentyl)sulfonyl-5-nitrobenzamide;2-ethyl-4-(2-methylcyclopentyl)sulfonyl-5-nitrobenzoyl chloride (PubChem CID 157077664) has the molecular formula C31H40ClN5O10S2 and a molecular weight of 742.27 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-ethyl-4-(2-methylcyclopentyl)sulfonyl-5-nitrobenzamide;2-ethyl-4-(2-methylcyclopentyl)sulfonyl-5-nitrobenzoyl chloride.
| Compound Name | N-(diaminomethylidene)-2-ethyl-4-(2-methylcyclopentyl)sulfonyl-5-nitrobenzamide;2-ethyl-4-(2-methylcyclopentyl)sulfonyl-5-nitrobenzoyl chloride |
|---|---|
| PubChem CID | 157077664 |
| Molecular Formula | C31H40ClN5O10S2 |
| Molecular Weight | 742.27 g/mol |
| Exact Mass | 741.19 |
| IUPAC Name | N-(diaminomethylidene)-2-ethyl-4-(2-methylcyclopentyl)sulfonyl-5-nitrobenzamide;2-ethyl-4-(2-methylcyclopentyl)sulfonyl-5-nitrobenzoyl chloride |
| SMILES | CCc1cc(S(=O)(=O)C2CCCC2C)c([N+](=O)[O-])cc1C(=O)Cl.CCc1cc(S(=O)(=O)C2CCCC2C)c([N+](=O)[O-])cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C16H22N4O5S.C15H18ClNO5S/c1-3-10-7-14(26(24,25)13-6-4-5-9(13)2)12(20(22)23)8-11(10)15(21)19-16(17)18;1-3-10-7-14(12(17(19)20)8-11(10)15(16)18)23(21,22)13-6-4-5-9(13)2/h7-9,13H,3-6H2,1-2H3,(H4,17,18,19,21);7-9,13H,3-6H2,1-2H3 |
| InChIKey | ADDWLDZDKFDHNO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 253.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.27 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|