C13H16N4O5S — CID 18927319
4-cyclopropylsulfonyl-N-(diaminomethylidene)-2-ethyl-5-nitrobenzamide (PubChem CID 18927319) has the molecular formula C13H16N4O5S and a molecular weight of 340.36 g/mol. Its IUPAC name is 4-cyclopropylsulfonyl-N-(diaminomethylidene)-2-ethyl-5-nitrobenzamide.
| Compound Name | 4-cyclopropylsulfonyl-N-(diaminomethylidene)-2-ethyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 18927319 |
| Molecular Formula | C13H16N4O5S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 4-cyclopropylsulfonyl-N-(diaminomethylidene)-2-ethyl-5-nitrobenzamide |
| SMILES | CCc1cc(S(=O)(=O)C2CC2)c([N+](=O)[O-])cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C13H16N4O5S/c1-2-7-5-11(23(21,22)8-3-4-8)10(17(19)20)6-9(7)12(18)16-13(14)15/h5-6,8H,2-4H2,1H3,(H4,14,15,16,18) |
| InChIKey | NDGSLWQZBISZJB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 158.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|