C16H15BrN4O3S — CID 18927369
4-(4-bromophenyl)sulfanyl-N-(diaminomethylidene)-2-ethyl-5-nitrobenzamide (PubChem CID 18927369) has the molecular formula C16H15BrN4O3S and a molecular weight of 423.29 g/mol. Its IUPAC name is 4-(4-bromophenyl)sulfanyl-N-(diaminomethylidene)-2-ethyl-5-nitrobenzamide.
| Compound Name | 4-(4-bromophenyl)sulfanyl-N-(diaminomethylidene)-2-ethyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 18927369 |
| Molecular Formula | C16H15BrN4O3S |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | 4-(4-bromophenyl)sulfanyl-N-(diaminomethylidene)-2-ethyl-5-nitrobenzamide |
| SMILES | CCc1cc(Sc2ccc(Br)cc2)c([N+](=O)[O-])cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C16H15BrN4O3S/c1-2-9-7-14(25-11-5-3-10(17)4-6-11)13(21(23)24)8-12(9)15(22)20-16(18)19/h3-8H,2H2,1H3,(H4,18,19,20,22) |
| InChIKey | KZAOCGGUAJOUQN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|