C27H36ClN5O10S2 — CID 160573997
4-tert-butylsulfonyl-N-(diaminomethylidene)-2-ethyl-5-nitrobenzamide;4-tert-butylsulfonyl-2-ethyl-5-nitrobenzoyl chloride (PubChem CID 160573997) has the molecular formula C27H36ClN5O10S2 and a molecular weight of 690.20 g/mol. Its IUPAC name is 4-tert-butylsulfonyl-N-(diaminomethylidene)-2-ethyl-5-nitrobenzamide;4-tert-butylsulfonyl-2-ethyl-5-nitrobenzoyl chloride.
| Compound Name | 4-tert-butylsulfonyl-N-(diaminomethylidene)-2-ethyl-5-nitrobenzamide;4-tert-butylsulfonyl-2-ethyl-5-nitrobenzoyl chloride |
|---|---|
| PubChem CID | 160573997 |
| Molecular Formula | C27H36ClN5O10S2 |
| Molecular Weight | 690.20 g/mol |
| Exact Mass | 689.16 |
| IUPAC Name | 4-tert-butylsulfonyl-N-(diaminomethylidene)-2-ethyl-5-nitrobenzamide;4-tert-butylsulfonyl-2-ethyl-5-nitrobenzoyl chloride |
| SMILES | CCc1cc(S(=O)(=O)C(C)(C)C)c([N+](=O)[O-])cc1C(=O)Cl.CCc1cc(S(=O)(=O)C(C)(C)C)c([N+](=O)[O-])cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C14H20N4O5S.C13H16ClNO5S/c1-5-8-6-11(24(22,23)14(2,3)4)10(18(20)21)7-9(8)12(19)17-13(15)16;1-5-8-6-11(21(19,20)13(2,3)4)10(15(17)18)7-9(8)12(14)16/h6-7H,5H2,1-4H3,(H4,15,16,17,19);6-7H,5H2,1-4H3 |
| InChIKey | RAXHGSZCQBZPOW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 253.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.20 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|