C14H18ClNO5S — CID 140975842
2-ethyl-5-nitro-4-pentan-3-ylsulfonylbenzoyl chloride (PubChem CID 140975842) has the molecular formula C14H18ClNO5S and a molecular weight of 347.82 g/mol. Its IUPAC name is 2-ethyl-5-nitro-4-pentan-3-ylsulfonylbenzoyl chloride.
| Compound Name | 2-ethyl-5-nitro-4-pentan-3-ylsulfonylbenzoyl chloride |
|---|---|
| PubChem CID | 140975842 |
| Molecular Formula | C14H18ClNO5S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2-ethyl-5-nitro-4-pentan-3-ylsulfonylbenzoyl chloride |
| SMILES | CCc1cc(S(=O)(=O)C(CC)CC)c([N+](=O)[O-])cc1C(=O)Cl |
| InChI | InChI=1S/C14H18ClNO5S/c1-4-9-7-13(22(20,21)10(5-2)6-3)12(16(18)19)8-11(9)14(15)17/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | MDZHYLWZONHXOQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 94.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|