C13H15NO6S — CID 151728092
4-cyclobutylsulfonyl-2-ethyl-5-nitrobenzoic acid (PubChem CID 151728092) has the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. Its IUPAC name is 4-cyclobutylsulfonyl-2-ethyl-5-nitrobenzoic acid.
| Compound Name | 4-cyclobutylsulfonyl-2-ethyl-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 151728092 |
| Molecular Formula | C13H15NO6S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 4-cyclobutylsulfonyl-2-ethyl-5-nitrobenzoic acid |
| SMILES | CCc1cc(S(=O)(=O)C2CCC2)c([N+](=O)[O-])cc1C(=O)O |
| InChI | InChI=1S/C13H15NO6S/c1-2-8-6-12(21(19,20)9-4-3-5-9)11(14(17)18)7-10(8)13(15)16/h6-7,9H,2-5H2,1H3,(H,15,16) |
| InChIKey | RJZQYFYULXHJDK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|