C29H36ClN5O10S2 — CID 157076910
4-cyclohexylsulfonyl-N-(diaminomethylidene)-2-methyl-5-nitrobenzamide;4-cyclohexylsulfonyl-2-methyl-5-nitrobenzoyl chloride (PubChem CID 157076910) has the molecular formula C29H36ClN5O10S2 and a molecular weight of 714.22 g/mol. Its IUPAC name is 4-cyclohexylsulfonyl-N-(diaminomethylidene)-2-methyl-5-nitrobenzamide;4-cyclohexylsulfonyl-2-methyl-5-nitrobenzoyl chloride.
| Compound Name | 4-cyclohexylsulfonyl-N-(diaminomethylidene)-2-methyl-5-nitrobenzamide;4-cyclohexylsulfonyl-2-methyl-5-nitrobenzoyl chloride |
|---|---|
| PubChem CID | 157076910 |
| Molecular Formula | C29H36ClN5O10S2 |
| Molecular Weight | 714.22 g/mol |
| Exact Mass | 713.16 |
| IUPAC Name | 4-cyclohexylsulfonyl-N-(diaminomethylidene)-2-methyl-5-nitrobenzamide;4-cyclohexylsulfonyl-2-methyl-5-nitrobenzoyl chloride |
| SMILES | Cc1cc(S(=O)(=O)C2CCCCC2)c([N+](=O)[O-])cc1C(=O)Cl.Cc1cc(S(=O)(=O)C2CCCCC2)c([N+](=O)[O-])cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C15H20N4O5S.C14H16ClNO5S/c1-9-7-13(25(23,24)10-5-3-2-4-6-10)12(19(21)22)8-11(9)14(20)18-15(16)17;1-9-7-13(12(16(18)19)8-11(9)14(15)17)22(20,21)10-5-3-2-4-6-10/h7-8,10H,2-6H2,1H3,(H4,16,17,18,20);7-8,10H,2-6H2,1H3 |
| InChIKey | ADBPIPWHLMCCGB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 253.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.22 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|