C13H16N4O3 — CID 19688195
4-but-3-enyl-N-(diaminomethylidene)-2-methyl-5-nitrobenzamide (PubChem CID 19688195) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-but-3-enyl-N-(diaminomethylidene)-2-methyl-5-nitrobenzamide.
| Compound Name | 4-but-3-enyl-N-(diaminomethylidene)-2-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 19688195 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 4-but-3-enyl-N-(diaminomethylidene)-2-methyl-5-nitrobenzamide |
| SMILES | C=CCCc1cc(C)c(C(=O)N=C(N)N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N4O3/c1-3-4-5-9-6-8(2)10(7-11(9)17(19)20)12(18)16-13(14)15/h3,6-7H,1,4-5H2,2H3,(H4,14,15,16,18) |
| InChIKey | LCAZMQNFPSFCQU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|