C25H32ClN5O10S2 — CID 159008620
4-tert-butylsulfonyl-N-(diaminomethylidene)-2-methyl-5-nitrobenzamide;4-tert-butylsulfonyl-2-methyl-5-nitrobenzoyl chloride (PubChem CID 159008620) has the molecular formula C25H32ClN5O10S2 and a molecular weight of 662.14 g/mol. Its IUPAC name is 4-tert-butylsulfonyl-N-(diaminomethylidene)-2-methyl-5-nitrobenzamide;4-tert-butylsulfonyl-2-methyl-5-nitrobenzoyl chloride.
| Compound Name | 4-tert-butylsulfonyl-N-(diaminomethylidene)-2-methyl-5-nitrobenzamide;4-tert-butylsulfonyl-2-methyl-5-nitrobenzoyl chloride |
|---|---|
| PubChem CID | 159008620 |
| Molecular Formula | C25H32ClN5O10S2 |
| Molecular Weight | 662.14 g/mol |
| Exact Mass | 661.13 |
| IUPAC Name | 4-tert-butylsulfonyl-N-(diaminomethylidene)-2-methyl-5-nitrobenzamide;4-tert-butylsulfonyl-2-methyl-5-nitrobenzoyl chloride |
| SMILES | Cc1cc(S(=O)(=O)C(C)(C)C)c([N+](=O)[O-])cc1C(=O)Cl.Cc1cc(S(=O)(=O)C(C)(C)C)c([N+](=O)[O-])cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C13H18N4O5S.C12H14ClNO5S/c1-7-5-10(23(21,22)13(2,3)4)9(17(19)20)6-8(7)11(18)16-12(14)15;1-7-5-10(20(18,19)12(2,3)4)9(14(16)17)6-8(7)11(13)15/h5-6H,1-4H3,(H4,14,15,16,18);5-6H,1-4H3 |
| InChIKey | JSFRKRQHPCYZIY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 253.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.14 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|