C25H28ClF6N3O6S2 — CID 161059626
N-(diaminomethylidene)-2-methyl-4-propylsulfonyl-5-(trifluoromethyl)benzamide;2-methyl-4-propylsulfonyl-5-(trifluoromethyl)benzoyl chloride (PubChem CID 161059626) has the molecular formula C25H28ClF6N3O6S2 and a molecular weight of 680.09 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-methyl-4-propylsulfonyl-5-(trifluoromethyl)benzamide;2-methyl-4-propylsulfonyl-5-(trifluoromethyl)benzoyl chloride.
| Compound Name | N-(diaminomethylidene)-2-methyl-4-propylsulfonyl-5-(trifluoromethyl)benzamide;2-methyl-4-propylsulfonyl-5-(trifluoromethyl)benzoyl chloride |
|---|---|
| PubChem CID | 161059626 |
| Molecular Formula | C25H28ClF6N3O6S2 |
| Molecular Weight | 680.09 g/mol |
| Exact Mass | 679.10 |
| IUPAC Name | N-(diaminomethylidene)-2-methyl-4-propylsulfonyl-5-(trifluoromethyl)benzamide;2-methyl-4-propylsulfonyl-5-(trifluoromethyl)benzoyl chloride |
| SMILES | CCCS(=O)(=O)c1cc(C)c(C(=O)Cl)cc1C(F)(F)F.CCCS(=O)(=O)c1cc(C)c(C(=O)N=C(N)N)cc1C(F)(F)F |
| InChI | InChI=1S/C13H16F3N3O3S.C12H12ClF3O3S/c1-3-4-23(21,22)10-5-7(2)8(11(20)19-12(17)18)6-9(10)13(14,15)16;1-3-4-20(18,19)10-5-7(2)8(11(13)17)6-9(10)12(14,15)16/h5-6H,3-4H2,1-2H3,(H4,17,18,19,20);5-6H,3-4H2,1-2H3 |
| InChIKey | UDFNRCFFQAEOCR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 166.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.09 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|