C33H28ClF6N3O6S2 — CID 159287483
4-(benzenesulfonyl)-N-(diaminomethylidene)-2-ethyl-5-(trifluoromethyl)benzamide;4-(benzenesulfonyl)-2-ethyl-5-(trifluoromethyl)benzoyl chloride (PubChem CID 159287483) has the molecular formula C33H28ClF6N3O6S2 and a molecular weight of 776.18 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-(diaminomethylidene)-2-ethyl-5-(trifluoromethyl)benzamide;4-(benzenesulfonyl)-2-ethyl-5-(trifluoromethyl)benzoyl chloride.
| Compound Name | 4-(benzenesulfonyl)-N-(diaminomethylidene)-2-ethyl-5-(trifluoromethyl)benzamide;4-(benzenesulfonyl)-2-ethyl-5-(trifluoromethyl)benzoyl chloride |
|---|---|
| PubChem CID | 159287483 |
| Molecular Formula | C33H28ClF6N3O6S2 |
| Molecular Weight | 776.18 g/mol |
| Exact Mass | 775.10 |
| IUPAC Name | 4-(benzenesulfonyl)-N-(diaminomethylidene)-2-ethyl-5-(trifluoromethyl)benzamide;4-(benzenesulfonyl)-2-ethyl-5-(trifluoromethyl)benzoyl chloride |
| SMILES | CCc1cc(S(=O)(=O)c2ccccc2)c(C(F)(F)F)cc1C(=O)Cl.CCc1cc(S(=O)(=O)c2ccccc2)c(C(F)(F)F)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C17H16F3N3O3S.C16H12ClF3O3S/c1-2-10-8-14(27(25,26)11-6-4-3-5-7-11)13(17(18,19)20)9-12(10)15(24)23-16(21)22;1-2-10-8-14(24(22,23)11-6-4-3-5-7-11)13(16(18,19)20)9-12(10)15(17)21/h3-9H,2H2,1H3,(H4,21,22,23,24);3-9H,2H2,1H3 |
| InChIKey | KZRPTFSNIMSWGF-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 166.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.18 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|