C19H21F3N4O3S — CID 18930173
N-(diaminomethylidene)-2-ethyl-5-methylsulfonyl-4-[N-methyl-2-(trifluoromethyl)anilino]benzamide (PubChem CID 18930173) has the molecular formula C19H21F3N4O3S and a molecular weight of 442.46 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-ethyl-5-methylsulfonyl-4-[N-methyl-2-(trifluoromethyl)anilino]benzamide.
| Compound Name | N-(diaminomethylidene)-2-ethyl-5-methylsulfonyl-4-[N-methyl-2-(trifluoromethyl)anilino]benzamide |
|---|---|
| PubChem CID | 18930173 |
| Molecular Formula | C19H21F3N4O3S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-(diaminomethylidene)-2-ethyl-5-methylsulfonyl-4-[N-methyl-2-(trifluoromethyl)anilino]benzamide |
| SMILES | CCc1cc(N(C)c2ccccc2C(F)(F)F)c(S(C)(=O)=O)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C19H21F3N4O3S/c1-4-11-9-15(26(2)14-8-6-5-7-13(14)19(20,21)22)16(30(3,28)29)10-12(11)17(27)25-18(23)24/h5-10H,4H2,1-3H3,(H4,23,24,25,27) |
| InChIKey | VMJMYNWILRMXRX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|