C17H18ClN3O4S — CID 21463743
4-(2-chlorophenoxy)-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide (PubChem CID 21463743) has the molecular formula C17H18ClN3O4S and a molecular weight of 395.87 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide.
| Compound Name | 4-(2-chlorophenoxy)-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 21463743 |
| Molecular Formula | C17H18ClN3O4S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 4-(2-chlorophenoxy)-N-(diaminomethylidene)-2-ethyl-5-methylsulfonylbenzamide |
| SMILES | CCc1cc(Oc2ccccc2Cl)c(S(C)(=O)=O)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C17H18ClN3O4S/c1-3-10-8-14(25-13-7-5-4-6-12(13)18)15(26(2,23)24)9-11(10)16(22)21-17(19)20/h4-9H,3H2,1-2H3,(H4,19,20,21,22) |
| InChIKey | HFIXRDYVSIJKMN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|