C29H36ClN5O6 — CID 162175832
N-(diaminomethylidene)-4-hex-2-enyl-2-methyl-5-nitrobenzamide;4-hex-2-enyl-2-methyl-5-nitrobenzoyl chloride (PubChem CID 162175832) has the molecular formula C29H36ClN5O6 and a molecular weight of 586.09 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-hex-2-enyl-2-methyl-5-nitrobenzamide;4-hex-2-enyl-2-methyl-5-nitrobenzoyl chloride.
| Compound Name | N-(diaminomethylidene)-4-hex-2-enyl-2-methyl-5-nitrobenzamide;4-hex-2-enyl-2-methyl-5-nitrobenzoyl chloride |
|---|---|
| PubChem CID | 162175832 |
| Molecular Formula | C29H36ClN5O6 |
| Molecular Weight | 586.09 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | N-(diaminomethylidene)-4-hex-2-enyl-2-methyl-5-nitrobenzamide;4-hex-2-enyl-2-methyl-5-nitrobenzoyl chloride |
| SMILES | CCCC=CCc1cc(C)c(C(=O)Cl)cc1[N+](=O)[O-].CCCC=CCc1cc(C)c(C(=O)N=C(N)N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N4O3.C14H16ClNO3/c1-3-4-5-6-7-11-8-10(2)12(9-13(11)19(21)22)14(20)18-15(16)17;1-3-4-5-6-7-11-8-10(2)12(14(15)17)9-13(11)16(18)19/h5-6,8-9H,3-4,7H2,1-2H3,(H4,16,17,18,20);5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | ZOJPWFFWUUHHKZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 184.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.09 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|